C27H60O — CID 163898704
2-ethyl-3,3-dimethylbutan-1-ol;3-ethyl-2,2,4-trimethylpentane;2,2,4,4-tetramethylpentane (PubChem CID 163898704) has the molecular formula C27H60O and a molecular weight of 400.78 g/mol. Its IUPAC name is 2-ethyl-3,3-dimethylbutan-1-ol;3-ethyl-2,2,4-trimethylpentane;2,2,4,4-tetramethylpentane.
| Compound Name | 2-ethyl-3,3-dimethylbutan-1-ol;3-ethyl-2,2,4-trimethylpentane;2,2,4,4-tetramethylpentane |
|---|---|
| PubChem CID | 163898704 |
| Molecular Formula | C27H60O |
| Molecular Weight | 400.78 g/mol |
| Exact Mass | 400.46 |
| IUPAC Name | 2-ethyl-3,3-dimethylbutan-1-ol;3-ethyl-2,2,4-trimethylpentane;2,2,4,4-tetramethylpentane |
| SMILES | CC(C)(C)CC(C)(C)C.CCC(C(C)C)C(C)(C)C.CCC(CO)C(C)(C)C |
| InChI | InChI=1S/C10H22.C9H20.C8H18O/c1-7-9(8(2)3)10(4,5)6;1-8(2,3)7-9(4,5)6;1-5-7(6-9)8(2,3)4/h8-9H,7H2,1-6H3;7H2,1-6H3;7,9H,5-6H2,1-4H3 |
| InChIKey | QHXKIWGWEMELAR-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.78 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |