C11H18N6 — CID 163899397
2-N,2-N-bis[(Z)-but-2-enyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 163899397) has the molecular formula C11H18N6 and a molecular weight of 234.31 g/mol. Its IUPAC name is 2-N,2-N-bis[(Z)-but-2-enyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-bis[(Z)-but-2-enyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 163899397 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-N,2-N-bis[(Z)-but-2-enyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | C/C=C\CN(C/C=C\C)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C11H18N6/c1-3-5-7-17(8-6-4-2)11-15-9(12)14-10(13)16-11/h3-6H,7-8H2,1-2H3,(H4,12,13,14,15,16)/b5-3-,6-4- |
| InChIKey | QIMLCKJINOLHCJ-GLIMQPGKSA-N |
| XLogP | 0.99 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|