C11H15N — CID 163899552
1-(2,3,7,7a-tetrahydro-1H-inden-5-yl)ethanimine (PubChem CID 163899552) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 1-(2,3,7,7a-tetrahydro-1H-inden-5-yl)ethanimine.
| Compound Name | 1-(2,3,7,7a-tetrahydro-1H-inden-5-yl)ethanimine |
|---|---|
| PubChem CID | 163899552 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1-(2,3,7,7a-tetrahydro-1H-inden-5-yl)ethanimine |
| SMILES | [H]/N=C(\C)C1=CCC2CCCC2=C1 |
| InChI | InChI=1S/C11H15N/c1-8(12)10-6-5-9-3-2-4-11(9)7-10/h6-7,9,12H,2-5H2,1H3/b12-8+ |
| InChIKey | QIPVSZJWXFHUQZ-XYOKQWHBSA-N |
| XLogP | 3.08 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|