C48H30N4O — CID 163899892
5-[3-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-8-oxa-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene (PubChem CID 163899892) has the molecular formula C48H30N4O and a molecular weight of 678.80 g/mol. Its IUPAC name is 5-[3-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-8-oxa-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene.
| Compound Name | 5-[3-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-8-oxa-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 163899892 |
| Molecular Formula | C48H30N4O |
| Molecular Weight | 678.80 g/mol |
| Exact Mass | 678.24 |
| IUPAC Name | 5-[3-[4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]phenyl]-8-oxa-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc(-c5cccc(-c6ccc7c(c6)Oc6cccc8ccnc-7c68)c5)cc4)c3)n2)cc1 |
| InChI | InChI=1S/C48H30N4O/c1-3-10-34(11-4-1)46-50-47(35-12-5-2-6-13-35)52-48(51-46)40-18-8-16-37(29-40)32-22-20-31(21-23-32)36-15-7-17-38(28-36)39-24-25-41-43(30-39)53-42-19-9-14-33-26-27-49-45(41)44(33)42/h1-30H |
| InChIKey | QIWVFBLBKPRXOB-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.80 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |