C9H14F2N2 — CID 163900913
(1E,3Z)-4-N-ethyl-1-fluoro-4-N-[(E)-2-fluoroethenyl]penta-1,3-diene-1,4-diamine (PubChem CID 163900913) has the molecular formula C9H14F2N2 and a molecular weight of 188.22 g/mol. Its IUPAC name is (1E,3Z)-4-N-ethyl-1-fluoro-4-N-[(E)-2-fluoroethenyl]penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-4-N-ethyl-1-fluoro-4-N-[(E)-2-fluoroethenyl]penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 163900913 |
| Molecular Formula | C9H14F2N2 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | (1E,3Z)-4-N-ethyl-1-fluoro-4-N-[(E)-2-fluoroethenyl]penta-1,3-diene-1,4-diamine |
| SMILES | CCN(/C=C/F)/C(C)=C\C=C(/N)F |
| InChI | InChI=1S/C9H14F2N2/c1-3-13(7-6-10)8(2)4-5-9(11)12/h4-7H,3,12H2,1-2H3/b7-6+,8-4-,9-5- |
| InChIKey | QJUGQWFWELNNRB-BHNCQTOBSA-N |
| XLogP | 2.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|