C21H26N2O6S4 — CID 163900983
2-(pyridin-2-yldisulfanyl)ethyl 6-[6-(2-hydroxyethyldisulfanyl)-3-pyridinyl]-7-methyl-1,3,5-trioxocane-7-carboxylate (PubChem CID 163900983) has the molecular formula C21H26N2O6S4 and a molecular weight of 530.72 g/mol. Its IUPAC name is 2-(pyridin-2-yldisulfanyl)ethyl 6-[6-(2-hydroxyethyldisulfanyl)-3-pyridinyl]-7-methyl-1,3,5-trioxocane-7-carboxylate.
| Compound Name | 2-(pyridin-2-yldisulfanyl)ethyl 6-[6-(2-hydroxyethyldisulfanyl)-3-pyridinyl]-7-methyl-1,3,5-trioxocane-7-carboxylate |
|---|---|
| PubChem CID | 163900983 |
| Molecular Formula | C21H26N2O6S4 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | 2-(pyridin-2-yldisulfanyl)ethyl 6-[6-(2-hydroxyethyldisulfanyl)-3-pyridinyl]-7-methyl-1,3,5-trioxocane-7-carboxylate |
| SMILES | CC1(C(=O)OCCSSc2ccccn2)COCOCOC1c1ccc(SSCCO)nc1 |
| InChI | InChI=1S/C21H26N2O6S4/c1-21(20(25)28-9-11-31-32-17-4-2-3-7-22-17)13-26-14-27-15-29-19(21)16-5-6-18(23-12-16)33-30-10-8-24/h2-7,12,19,24H,8-11,13-15H2,1H3 |
| InChIKey | QJVNVBMJOBIHRW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|