C22H31N3O2 — CID 163901383
3-methyl-1-[[(1E,3Z,5E,7Z,9E,11S)-9-methyl-11-pyridazin-3-yloxydodeca-1,3,5,7,9-pentaenyl]amino]butan-2-ol (PubChem CID 163901383) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 3-methyl-1-[[(1E,3Z,5E,7Z,9E,11S)-9-methyl-11-pyridazin-3-yloxydodeca-1,3,5,7,9-pentaenyl]amino]butan-2-ol.
| Compound Name | 3-methyl-1-[[(1E,3Z,5E,7Z,9E,11S)-9-methyl-11-pyridazin-3-yloxydodeca-1,3,5,7,9-pentaenyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 163901383 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 3-methyl-1-[[(1E,3Z,5E,7Z,9E,11S)-9-methyl-11-pyridazin-3-yloxydodeca-1,3,5,7,9-pentaenyl]amino]butan-2-ol |
| SMILES | CC(/C=C\C=C\C=C/C=C/NCC(O)C(C)C)=C\[C@H](C)Oc1cccnn1 |
| InChI | InChI=1S/C22H31N3O2/c1-18(2)21(26)17-23-14-10-8-6-5-7-9-12-19(3)16-20(4)27-22-13-11-15-24-25-22/h5-16,18,20-21,23,26H,17H2,1-4H3/b7-5+,8-6-,12-9-,14-10+,19-16+/t20-,21?/m0/s1 |
| InChIKey | QKDZGUZYWOKUNO-BCXVKMPESA-N |
| XLogP | 3.98 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|