C21H22NO3+ — CID 163901828
[3-carboxy-6-[(4-propan-2-ylanilino)methyl]naphthalen-2-yl]oxidanium (PubChem CID 163901828) has the molecular formula C21H22NO3+ and a molecular weight of 336.41 g/mol. Its IUPAC name is [3-carboxy-6-[(4-propan-2-ylanilino)methyl]naphthalen-2-yl]oxidanium.
| Compound Name | [3-carboxy-6-[(4-propan-2-ylanilino)methyl]naphthalen-2-yl]oxidanium |
|---|---|
| PubChem CID | 163901828 |
| Molecular Formula | C21H22NO3+ |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [3-carboxy-6-[(4-propan-2-ylanilino)methyl]naphthalen-2-yl]oxidanium |
| SMILES | CC(C)c1ccc(NCc2ccc3cc([OH2+])c(C(=O)O)cc3c2)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-13(2)15-5-7-18(8-6-15)22-12-14-3-4-16-11-20(23)19(21(24)25)10-17(16)9-14/h3-11,13,22-23H,12H2,1-2H3,(H,24,25)/p+1 |
| InChIKey | QKMXBEZLGNNTIJ-UHFFFAOYSA-O |
| XLogP | 4.71 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|