C34H45N5O2 — CID 163901955
(1R)-1'-[(1S,2R)-1-[(4-aminocyclohexanecarbonyl)amino]-2-(1H-indol-3-yl)propyl]-N,N-dimethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-carboxamide (PubChem CID 163901955) has the molecular formula C34H45N5O2 and a molecular weight of 555.77 g/mol. Its IUPAC name is (1R)-1'-[(1S,2R)-1-[(4-aminocyclohexanecarbonyl)amino]-2-(1H-indol-3-yl)propyl]-N,N-dimethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-carboxamide.
| Compound Name | (1R)-1'-[(1S,2R)-1-[(4-aminocyclohexanecarbonyl)amino]-2-(1H-indol-3-yl)propyl]-N,N-dimethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-carboxamide |
|---|---|
| PubChem CID | 163901955 |
| Molecular Formula | C34H45N5O2 |
| Molecular Weight | 555.77 g/mol |
| Exact Mass | 555.36 |
| IUPAC Name | (1R)-1'-[(1S,2R)-1-[(4-aminocyclohexanecarbonyl)amino]-2-(1H-indol-3-yl)propyl]-N,N-dimethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-carboxamide |
| SMILES | C[C@H](c1c[nH]c2ccccc12)[C@@H](NC(=O)C1CCC(N)CC1)N1CCC2(CC1)C[C@@H](C(=O)N(C)C)c1ccccc12 |
| InChI | InChI=1S/C34H45N5O2/c1-22(28-21-36-30-11-7-5-9-26(28)30)31(37-32(40)23-12-14-24(35)15-13-23)39-18-16-34(17-19-39)20-27(33(41)38(2)3)25-8-4-6-10-29(25)34/h4-11,21-24,27,31,36H,12-20,35H2,1-3H3,(H,37,40)/t22-,23?,24?,27-,31+/m1/s1 |
| InChIKey | QKPTYQUNUGEDFK-ULMVJINXSA-N |
| XLogP | 4.84 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.77 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |