C23H23ClN4O2 — CID 163903544
N-[(9R)-11-(4-chlorophenyl)-14-methoxy-5-methyl-6,7,10-triazatricyclo[10.4.0.04,8]hexadeca-1(12),5,7,10,13,15-hexaen-9-yl]acetamide (PubChem CID 163903544) has the molecular formula C23H23ClN4O2 and a molecular weight of 422.92 g/mol. Its IUPAC name is N-[(9R)-11-(4-chlorophenyl)-14-methoxy-5-methyl-6,7,10-triazatricyclo[10.4.0.04,8]hexadeca-1(12),5,7,10,13,15-hexaen-9-yl]acetamide.
| Compound Name | N-[(9R)-11-(4-chlorophenyl)-14-methoxy-5-methyl-6,7,10-triazatricyclo[10.4.0.04,8]hexadeca-1(12),5,7,10,13,15-hexaen-9-yl]acetamide |
|---|---|
| PubChem CID | 163903544 |
| Molecular Formula | C23H23ClN4O2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-[(9R)-11-(4-chlorophenyl)-14-methoxy-5-methyl-6,7,10-triazatricyclo[10.4.0.04,8]hexadeca-1(12),5,7,10,13,15-hexaen-9-yl]acetamide |
| SMILES | COc1ccc2c(c1)C(c1ccc(Cl)cc1)=N[C@@H](NC(C)=O)C1=NN=C(C)C1CC2 |
| InChI | InChI=1S/C23H23ClN4O2/c1-13-19-11-7-15-6-10-18(30-3)12-20(15)21(16-4-8-17(24)9-5-16)26-23(25-14(2)29)22(19)28-27-13/h4-6,8-10,12,19,23H,7,11H2,1-3H3,(H,25,29)/t19?,23-/m1/s1 |
| InChIKey | QLXXGHKHXUHVHZ-LEQGEALCSA-N |
| XLogP | 4.04 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |