C27H27N3O5 — CID 163903592
4-[(2S,3R)-2,3-dihydroxy-4-[(2-hydroxyethylamino)methyl]-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile (PubChem CID 163903592) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is 4-[(2S,3R)-2,3-dihydroxy-4-[(2-hydroxyethylamino)methyl]-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile.
| Compound Name | 4-[(2S,3R)-2,3-dihydroxy-4-[(2-hydroxyethylamino)methyl]-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
|---|---|
| PubChem CID | 163903592 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 4-[(2S,3R)-2,3-dihydroxy-4-[(2-hydroxyethylamino)methyl]-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile |
| SMILES | COc1cncc2c1[C@]1(O)[C@H](O)C(CNCCO)C(c3ccccc3)C1(c1ccc(C#N)cc1)O2 |
| InChI | InChI=1S/C27H27N3O5/c1-34-21-15-30-16-22-24(21)26(33)25(32)20(14-29-11-12-31)23(18-5-3-2-4-6-18)27(26,35-22)19-9-7-17(13-28)8-10-19/h2-10,15-16,20,23,25,29,31-33H,11-12,14H2,1H3/t20?,23?,25-,26+,27?/m1/s1 |
| InChIKey | QLZBLHMWXZGHTC-ACPFFUGHSA-N |
| XLogP | 1.79 |
| TPSA | 127.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|