C13H19NO4 — CID 163903797
1-[[(2E,4Z)-5-hydroxy-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 163903797) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-[[(2E,4Z)-5-hydroxy-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[(2E,4Z)-5-hydroxy-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 163903797 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-[[(2E,4Z)-5-hydroxy-2-methylpenta-2,4-dienoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | C/C(=C\C=C/O)C(=O)NC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C13H19NO4/c1-10(6-5-9-15)11(16)14-13(12(17)18)7-3-2-4-8-13/h5-6,9,15H,2-4,7-8H2,1H3,(H,14,16)(H,17,18)/b9-5-,10-6+ |
| InChIKey | QMDAORMJRXIESV-VTBWALSUSA-N |
| XLogP | 1.91 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|