About (4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione
(4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione (PubChem CID 163904070) has the molecular formula C17H18N2O3
and a molecular weight of 299.35 g/mol. Its IUPAC name is (4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione.
Molecular Properties
| Compound Name | (4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione |
| PubChem CID | 163904070 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | (4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione |
| SMILES | [2H][C@@]1(n2c(C)nc3ccc(C)cc3c2=O)CCCC(=O)CC1=O |
| InChI | InChI=1S/C17H18N2O3/c1-10-6-7-14-13(8-10)17(22)19(11(2)18-14)15-5-3-4-12(20)9-16(15)21/h6-8,15H,3-5,9H2,1-2H3/t15-/m1/s1/i15D |
| InChIKey | QMJONEZXKNVELW-ROGGJZNOSA-N |
| XLogP | 2.27 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione?
The IUPAC name of (4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione (CID 163904070) is (4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione.
What is the SMILES notation for (4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione?
The canonical SMILES for (4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione is [2H][C@@]1(n2c(C)nc3ccc(C)cc3c2=O)CCCC(=O)CC1=O.
What is the InChIKey of (4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione?
The InChIKey is QMJONEZXKNVELW-ROGGJZNOSA-N. The full InChI is InChI=1S/C17H18N2O3/c1-10-6-7-14-13(8-10)17(22)19(11(2)18-14)15-5-3-4-12(20)9-16(15)21/h6-8,15H,3-5,9H2,1-2H3/t15-/m1/s1/i15D.
What are the key properties of (4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione?
(4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione has a molecular weight of 299.35 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-deuterio-4-(2,6-dimethyl-4-oxoquinazolin-3-yl)cycloheptane-1,3-dione is sourced from PubChem (CID 163904070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).