C37H45ClN5O7S- — CID 163904174
CID 163904174 (PubChem CID 163904174) has the molecular formula C37H45ClN5O7S- and a molecular weight of 739.31 g/mol.
| Compound Name | CID 163904174 |
|---|---|
| PubChem CID | 163904174 |
| Molecular Formula | C37H45ClN5O7S- |
| Molecular Weight | 739.31 g/mol |
| Exact Mass | 738.27 |
| IUPAC Name | — |
| SMILES | COc1nn(C)cc1C(=O)NC1C(C)C(O)C=CC(OC)C2CCC2CN2Cc3ccc(Cl)cc3CCCCOc3ccc(cc32)C(=O)/N=[S-]/1=O |
| InChI | InChI=1S/C37H45ClN5O7S/c1-22-31(44)13-15-32(48-3)28-12-9-26(28)20-43-19-25-8-11-27(38)17-23(25)7-5-6-16-50-33-14-10-24(18-30(33)43)34(45)41-51(47)37(22)39-35(46)29-21-42(2)40-36(29)49-4/h8,10-11,13-15,17-18,21-22,26,28,31-32,37,44H,5-7,9,12,16,19-20H2,1-4H3,(H,39,46)/q-1 |
| InChIKey | VHBMFKOYLDWIFQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 144.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.31 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|