C28H50FN7O2 — CID 163904409
2-(diaminomethyl)-3-[(Z)-2-fluorooct-5-enyl]imino-N-[4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]hexanamide (PubChem CID 163904409) has the molecular formula C28H50FN7O2 and a molecular weight of 535.75 g/mol. Its IUPAC name is 2-(diaminomethyl)-3-[(Z)-2-fluorooct-5-enyl]imino-N-[4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]hexanamide.
| Compound Name | 2-(diaminomethyl)-3-[(Z)-2-fluorooct-5-enyl]imino-N-[4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 163904409 |
| Molecular Formula | C28H50FN7O2 |
| Molecular Weight | 535.75 g/mol |
| Exact Mass | 535.40 |
| IUPAC Name | 2-(diaminomethyl)-3-[(Z)-2-fluorooct-5-enyl]imino-N-[4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]hexanamide |
| SMILES | CC/C=C\CCC(F)C/N=C(\CCC)C(C(=O)NC1CNCCC1N1CCN2C(=O)CCCC2C1)C(N)N |
| InChI | InChI=1S/C28H50FN7O2/c1-3-5-6-7-10-20(29)17-33-22(9-4-2)26(27(30)31)28(38)34-23-18-32-14-13-24(23)35-15-16-36-21(19-35)11-8-12-25(36)37/h5-6,20-21,23-24,26-27,32H,3-4,7-19,30-31H2,1-2H3,(H,34,38)/b6-5-,33-22+ |
| InChIKey | QMRBVUMROASYLU-YGUFNKRXSA-N |
| XLogP | 1.72 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|