C8H9N2O+ — CID 163905176
5-methyl-1-azoniacyclohepta-1,3,5,7-tetraene-2-carboxamide (PubChem CID 163905176) has the molecular formula C8H9N2O+ and a molecular weight of 149.17 g/mol. Its IUPAC name is 5-methyl-1-azoniacyclohepta-1,3,5,7-tetraene-2-carboxamide.
| Compound Name | 5-methyl-1-azoniacyclohepta-1,3,5,7-tetraene-2-carboxamide |
|---|---|
| PubChem CID | 163905176 |
| Molecular Formula | C8H9N2O+ |
| Molecular Weight | 149.17 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 5-methyl-1-azoniacyclohepta-1,3,5,7-tetraene-2-carboxamide |
| SMILES | CC1=CC=[N+]=C(C(N)=O)C=C1 |
| InChI | InChI=1S/C8H8N2O/c1-6-2-3-7(8(9)11)10-5-4-6/h2-5H,1H3,(H-,9,11)/p+1 |
| InChIKey | CLJJPGCTSZPRHB-UHFFFAOYSA-O |
| XLogP | -0.43 |
| TPSA | 57.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.17 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|