About 2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one
2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one (PubChem CID 163905601) has the molecular formula C20H18N4O
and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one.
Molecular Properties
| Compound Name | 2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one |
| PubChem CID | 163905601 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one |
| SMILES | Cn1c(/C=C/c2ncc(C3C=CC=CC3)[nH]2)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H18N4O/c1-24-19(23-16-10-6-5-9-15(16)20(24)25)12-11-18-21-13-17(22-18)14-7-3-2-4-8-14/h2-7,9-14H,8H2,1H3,(H,21,22)/b12-11+ |
| InChIKey | QNPXDGXJKSNYGB-VAWYXSNFSA-N |
| XLogP | 3.43 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one?
The IUPAC name of 2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one (CID 163905601) is 2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one.
What is the SMILES notation for 2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one?
The canonical SMILES for 2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one is Cn1c(/C=C/c2ncc(C3C=CC=CC3)[nH]2)nc2ccccc2c1=O.
What is the InChIKey of 2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one?
The InChIKey is QNPXDGXJKSNYGB-VAWYXSNFSA-N. The full InChI is InChI=1S/C20H18N4O/c1-24-19(23-16-10-6-5-9-15(16)20(24)25)12-11-18-21-13-17(22-18)14-7-3-2-4-8-14/h2-7,9-14H,8H2,1H3,(H,21,22)/b12-11+.
What are the key properties of 2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one?
2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one has a molecular weight of 330.39 g/mol, XLogP of 3.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(5-cyclohexa-2,4-dien-1-yl-1H-imidazol-2-yl)ethenyl]-3-methylquinazolin-4-one is sourced from PubChem (CID 163905601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).