About 1-methyl-4a,8a-dihydroquinolin-4-imine
1-methyl-4a,8a-dihydroquinolin-4-imine (PubChem CID 163905803) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-methyl-4a,8a-dihydroquinolin-4-imine.
Molecular Properties
| Compound Name | 1-methyl-4a,8a-dihydroquinolin-4-imine |
| PubChem CID | 163905803 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1-methyl-4a,8a-dihydroquinolin-4-imine |
| SMILES | [H]/N=C1\C=CN(C)C2C=CC=CC12 |
| InChI | InChI=1S/C10H12N2/c1-12-7-6-9(11)8-4-2-3-5-10(8)12/h2-8,10-11H,1H3/b11-9+ |
| InChIKey | QNUGEPYEUIWLLJ-PKNBQFBNSA-N |
| XLogP | 1.58 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4a,8a-dihydroquinolin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4a,8a-dihydroquinolin-4-imine?
The IUPAC name of 1-methyl-4a,8a-dihydroquinolin-4-imine (CID 163905803) is 1-methyl-4a,8a-dihydroquinolin-4-imine.
What is the SMILES notation for 1-methyl-4a,8a-dihydroquinolin-4-imine?
The canonical SMILES for 1-methyl-4a,8a-dihydroquinolin-4-imine is [H]/N=C1\C=CN(C)C2C=CC=CC12.
What is the InChIKey of 1-methyl-4a,8a-dihydroquinolin-4-imine?
The InChIKey is QNUGEPYEUIWLLJ-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H12N2/c1-12-7-6-9(11)8-4-2-3-5-10(8)12/h2-8,10-11H,1H3/b11-9+.
What are the key properties of 1-methyl-4a,8a-dihydroquinolin-4-imine?
1-methyl-4a,8a-dihydroquinolin-4-imine has a molecular weight of 160.22 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4a,8a-dihydroquinolin-4-imine is sourced from PubChem (CID 163905803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).