About 4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine
4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine (PubChem CID 163906968) has the molecular formula C8H10IN2S-
and a molecular weight of 293.15 g/mol. Its IUPAC name is 4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine |
| PubChem CID | 163906968 |
| Molecular Formula | C8H10IN2S- |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.96 |
| IUPAC Name | 4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine |
| SMILES | C[I-]c1nc(C)c2c(n1)CSC2 |
| InChI | InChI=1S/C8H10IN2S/c1-5-6-3-12-4-7(6)11-8(9-2)10-5/h3-4H2,1-2H3/q-1 |
| InChIKey | POBLGDUUAXCFRD-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine?
The IUPAC name of 4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine (CID 163906968) is 4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine.
What is the SMILES notation for 4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine?
The canonical SMILES for 4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine is C[I-]c1nc(C)c2c(n1)CSC2.
What is the InChIKey of 4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine?
The InChIKey is POBLGDUUAXCFRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10IN2S/c1-5-6-3-12-4-7(6)11-8(9-2)10-5/h3-4H2,1-2H3/q-1.
What are the key properties of 4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine?
4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine has a molecular weight of 293.15 g/mol, XLogP of -1.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-methyliodanuidyl-5,7-dihydrothieno[3,4-d]pyrimidine is sourced from PubChem (CID 163906968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).