C11H20N2S — CID 163907024
1-[3-(2,3-dihydrothiophen-2-yl)propyl]piperazine (PubChem CID 163907024) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is 1-[3-(2,3-dihydrothiophen-2-yl)propyl]piperazine.
| Compound Name | 1-[3-(2,3-dihydrothiophen-2-yl)propyl]piperazine |
|---|---|
| PubChem CID | 163907024 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1-[3-(2,3-dihydrothiophen-2-yl)propyl]piperazine |
| SMILES | C1=CSC(CCCN2CCNCC2)C1 |
| InChI | InChI=1S/C11H20N2S/c1(3-11-4-2-10-14-11)7-13-8-5-12-6-9-13/h2,10-12H,1,3-9H2 |
| InChIKey | QOURZSNJXQKALN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |