C17H12Br2O — CID 163907659
(2E)-2-[(3,5-dibromophenyl)methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 163907659) has the molecular formula C17H12Br2O and a molecular weight of 392.09 g/mol. Its IUPAC name is (2E)-2-[(3,5-dibromophenyl)methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-2-[(3,5-dibromophenyl)methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 163907659 |
| Molecular Formula | C17H12Br2O |
| Molecular Weight | 392.09 g/mol |
| Exact Mass | 389.93 |
| IUPAC Name | (2E)-2-[(3,5-dibromophenyl)methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1/C(=C/c2cc(Br)cc(Br)c2)CCc2ccccc21 |
| InChI | InChI=1S/C17H12Br2O/c18-14-8-11(9-15(19)10-14)7-13-6-5-12-3-1-2-4-16(12)17(13)20/h1-4,7-10H,5-6H2/b13-7+ |
| InChIKey | QPJKXQITKACBTC-NTUHNPAUSA-N |
| XLogP | 5.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.09 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|