C22H20F7N7S — CID 163908193
8-[3,5-bis(trifluoromethyl)phenyl]-N-[(3S,4S)-3-fluoro-1-(3-methyl-2,5-dihydro-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 163908193) has the molecular formula C22H20F7N7S and a molecular weight of 547.50 g/mol. Its IUPAC name is 8-[3,5-bis(trifluoromethyl)phenyl]-N-[(3S,4S)-3-fluoro-1-(3-methyl-2,5-dihydro-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-[3,5-bis(trifluoromethyl)phenyl]-N-[(3S,4S)-3-fluoro-1-(3-methyl-2,5-dihydro-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 163908193 |
| Molecular Formula | C22H20F7N7S |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 8-[3,5-bis(trifluoromethyl)phenyl]-N-[(3S,4S)-3-fluoro-1-(3-methyl-2,5-dihydro-1,2,4-thiadiazol-5-yl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CC1=NC(N2CC[C@H](Nc3nc4c(-c5cc(C(F)(F)F)cc(C(F)(F)F)c5)cccn4n3)[C@@H](F)C2)SN1 |
| InChI | InChI=1S/C22H20F7N7S/c1-11-30-20(37-34-11)35-6-4-17(16(23)10-35)31-19-32-18-15(3-2-5-36(18)33-19)12-7-13(21(24,25)26)9-14(8-12)22(27,28)29/h2-3,5,7-9,16-17,20H,4,6,10H2,1H3,(H,30,34)(H,31,33)/t16-,17-,20?/m0/s1 |
| InChIKey | QPUJAVYKFKAJNO-NBJLRHFZSA-N |
| XLogP | 5.21 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|