C42H26N4S — CID 163908541
5-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]phenyl]quinoline (PubChem CID 163908541) has the molecular formula C42H26N4S and a molecular weight of 618.77 g/mol. Its IUPAC name is 5-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]phenyl]quinoline.
| Compound Name | 5-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]phenyl]quinoline |
|---|---|
| PubChem CID | 163908541 |
| Molecular Formula | C42H26N4S |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | 5-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]phenyl]quinoline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc4sc5c(-c6ccc(-c7cccc8ncccc78)cc6)cccc5c34)n2)cc1 |
| InChI | InChI=1S/C42H26N4S/c1-3-11-29(12-4-1)40-44-41(30-13-5-2-6-14-30)46-42(45-40)35-18-9-21-37-38(35)34-17-7-16-32(39(34)47-37)28-24-22-27(23-25-28)31-15-8-20-36-33(31)19-10-26-43-36/h1-26H |
| InChIKey | QQCFRQGCHKTHLD-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |