C26H32O4 — CID 163909186
8-[(E)-3,7-dimethyloct-2-enyl]-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one (PubChem CID 163909186) has the molecular formula C26H32O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is 8-[(E)-3,7-dimethyloct-2-enyl]-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one.
| Compound Name | 8-[(E)-3,7-dimethyloct-2-enyl]-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 163909186 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 8-[(E)-3,7-dimethyloct-2-enyl]-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc2c(c1C/C=C(\C)CCCC(C)C)OC(c1ccc(O)cc1)CC2=O |
| InChI | InChI=1S/C26H32O4/c1-17(2)6-5-7-18(3)8-13-22-24(29-4)15-14-21-23(28)16-25(30-26(21)22)19-9-11-20(27)12-10-19/h8-12,14-15,17,25,27H,5-7,13,16H2,1-4H3/b18-8+ |
| InChIKey | QQPONJJSQFLEDA-QGMBQPNBSA-N |
| XLogP | 6.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|