C7H12N4O — CID 163909388
2,7-dimethyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-ol (PubChem CID 163909388) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 2,7-dimethyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-ol.
| Compound Name | 2,7-dimethyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-ol |
|---|---|
| PubChem CID | 163909388 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 2,7-dimethyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-5-ol |
| SMILES | Cc1nc2n(n1)C(C)CC(O)N2 |
| InChI | InChI=1S/C7H12N4O/c1-4-3-6(12)9-7-8-5(2)10-11(4)7/h4,6,12H,3H2,1-2H3,(H,8,9,10) |
| InChIKey | QQUCPLBADVMWTB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |