About methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate
methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate (PubChem CID 163909567) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate.
Molecular Properties
| Compound Name | methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate |
| PubChem CID | 163909567 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate |
| SMILES | C/N=C(\C(=O)OC)C1CC=CC=C1C |
| InChI | InChI=1S/C11H15NO2/c1-8-6-4-5-7-9(8)10(12-2)11(13)14-3/h4-6,9H,7H2,1-3H3/b12-10- |
| InChIKey | QQXRHYYVPURNFQ-BENRWUELSA-N |
| XLogP | 1.75 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate?
The IUPAC name of methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate (CID 163909567) is methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate.
What is the SMILES notation for methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate?
The canonical SMILES for methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate is C/N=C(\C(=O)OC)C1CC=CC=C1C.
What is the InChIKey of methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate?
The InChIKey is QQXRHYYVPURNFQ-BENRWUELSA-N. The full InChI is InChI=1S/C11H15NO2/c1-8-6-4-5-7-9(8)10(12-2)11(13)14-3/h4-6,9H,7H2,1-3H3/b12-10-.
What are the key properties of methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate?
methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate has a molecular weight of 193.25 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-methylcyclohexa-2,4-dien-1-yl)-2-methyliminoacetate is sourced from PubChem (CID 163909567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).