C15H18N5+ — CID 163910018
[1-(8-cyanoquinoxalin-5-yl)-5-methylpiperidin-3-yl]azanium (PubChem CID 163910018) has the molecular formula C15H18N5+ and a molecular weight of 268.34 g/mol. Its IUPAC name is [1-(8-cyanoquinoxalin-5-yl)-5-methylpiperidin-3-yl]azanium.
| Compound Name | [1-(8-cyanoquinoxalin-5-yl)-5-methylpiperidin-3-yl]azanium |
|---|---|
| PubChem CID | 163910018 |
| Molecular Formula | C15H18N5+ |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | [1-(8-cyanoquinoxalin-5-yl)-5-methylpiperidin-3-yl]azanium |
| SMILES | CC1CC([NH3+])CN(c2ccc(C#N)c3nccnc23)C1 |
| InChI | InChI=1S/C15H17N5/c1-10-6-12(17)9-20(8-10)13-3-2-11(7-16)14-15(13)19-5-4-18-14/h2-5,10,12H,6,8-9,17H2,1H3/p+1 |
| InChIKey | QRGMQEALXUHLMK-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 80.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |