About (3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol
(3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol (PubChem CID 163910239) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is (3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol |
| PubChem CID | 163910239 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol |
| SMILES | COC1=C(N)C=C(N)CC1CO |
| InChI | InChI=1S/C8H14N2O2/c1-12-8-5(4-11)2-6(9)3-7(8)10/h3,5,11H,2,4,9-10H2,1H3 |
| InChIKey | QRKXHZMEOCPACV-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol?
The IUPAC name of (3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol (CID 163910239) is (3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol.
What is the SMILES notation for (3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol?
The canonical SMILES for (3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol is COC1=C(N)C=C(N)CC1CO.
What is the InChIKey of (3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol?
The InChIKey is QRKXHZMEOCPACV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-12-8-5(4-11)2-6(9)3-7(8)10/h3,5,11H,2,4,9-10H2,1H3.
What are the key properties of (3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol?
(3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol has a molecular weight of 170.21 g/mol, XLogP of -0.34, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-diamino-2-methoxycyclohexa-2,4-dien-1-yl)methanol is sourced from PubChem (CID 163910239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).