About N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide
N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide (PubChem CID 163910751) has the molecular formula C8H9N3O2S
and a molecular weight of 211.25 g/mol. Its IUPAC name is N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide.
Molecular Properties
| Compound Name | N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide |
| PubChem CID | 163910751 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide |
| SMILES | C=CC(=C)S(=O)(=O)Nc1cccnn1 |
| InChI | InChI=1S/C8H9N3O2S/c1-3-7(2)14(12,13)11-8-5-4-6-9-10-8/h3-6H,1-2H2,(H,10,11) |
| InChIKey | QRWFLPPJOBWBED-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide?
The IUPAC name of N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide (CID 163910751) is N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide.
What is the SMILES notation for N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide?
The canonical SMILES for N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide is C=CC(=C)S(=O)(=O)Nc1cccnn1.
What is the InChIKey of N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide?
The InChIKey is QRWFLPPJOBWBED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2S/c1-3-7(2)14(12,13)11-8-5-4-6-9-10-8/h3-6H,1-2H2,(H,10,11).
What are the key properties of N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide?
N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide has a molecular weight of 211.25 g/mol, XLogP of 0.92, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyridazin-3-ylbuta-1,3-diene-2-sulfonamide is sourced from PubChem (CID 163910751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).