C10H18O5 — CID 163911039
(3R,4S,5R,6S)-5-methoxy-6-methyl-6-prop-1-en-2-yloxane-2,3,4-triol (PubChem CID 163911039) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is (3R,4S,5R,6S)-5-methoxy-6-methyl-6-prop-1-en-2-yloxane-2,3,4-triol.
| Compound Name | (3R,4S,5R,6S)-5-methoxy-6-methyl-6-prop-1-en-2-yloxane-2,3,4-triol |
|---|---|
| PubChem CID | 163911039 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (3R,4S,5R,6S)-5-methoxy-6-methyl-6-prop-1-en-2-yloxane-2,3,4-triol |
| SMILES | C=C(C)[C@]1(C)OC(O)[C@H](O)[C@H](O)[C@H]1OC |
| InChI | InChI=1S/C10H18O5/c1-5(2)10(3)8(14-4)6(11)7(12)9(13)15-10/h6-9,11-13H,1H2,2-4H3/t6-,7+,8+,9?,10-/m0/s1 |
| InChIKey | QSCDBUHETIFXOU-GWSMWCQVSA-N |
| XLogP | -0.59 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|