C30H31NO4 — CID 163911255
(2S,4S)-4-(9H-fluoren-2-yl)-2-(4-methoxybutoxy)-N-phenyl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 163911255) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is (2S,4S)-4-(9H-fluoren-2-yl)-2-(4-methoxybutoxy)-N-phenyl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2S,4S)-4-(9H-fluoren-2-yl)-2-(4-methoxybutoxy)-N-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 163911255 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | (2S,4S)-4-(9H-fluoren-2-yl)-2-(4-methoxybutoxy)-N-phenyl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | COCCCCO[C@@H]1C[C@H](c2ccc3c(c2)Cc2ccccc2-3)C=C(C(=O)Nc2ccccc2)O1 |
| InChI | InChI=1S/C30H31NO4/c1-33-15-7-8-16-34-29-20-23(19-28(35-29)30(32)31-25-10-3-2-4-11-25)21-13-14-27-24(17-21)18-22-9-5-6-12-26(22)27/h2-6,9-14,17,19,23,29H,7-8,15-16,18,20H2,1H3,(H,31,32)/t23-,29+/m1/s1 |
| InChIKey | QSGHLQQIVLEEEZ-BTYSJIOQSA-N |
| XLogP | 6.05 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|