About N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide
N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide (PubChem CID 163911554) has the molecular formula C4H9N5O
and a molecular weight of 143.15 g/mol. Its IUPAC name is N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide |
| PubChem CID | 163911554 |
| Molecular Formula | C4H9N5O |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide |
| SMILES | CC(=O)NC1=NNN(C)N1 |
| InChI | InChI=1S/C4H9N5O/c1-3(10)5-4-6-8-9(2)7-4/h8H,1-2H3,(H2,5,6,7,10) |
| InChIKey | DVSQOVHSJAEKMZ-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide?
The IUPAC name of N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide (CID 163911554) is N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide.
What is the SMILES notation for N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide?
The canonical SMILES for N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide is CC(=O)NC1=NNN(C)N1.
What is the InChIKey of N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide?
The InChIKey is DVSQOVHSJAEKMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N5O/c1-3(10)5-4-6-8-9(2)7-4/h8H,1-2H3,(H2,5,6,7,10).
What are the key properties of N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide?
N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide has a molecular weight of 143.15 g/mol, XLogP of -1.65, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methyl-1,3-dihydrotetrazol-5-yl)acetamide is sourced from PubChem (CID 163911554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).