C28H50 — CID 163912333
2-(4-methylcyclohexyl)-5-[3-methyl-4-(4-methylcyclohexyl)pentan-2-yl]-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 163912333) has the molecular formula C28H50 and a molecular weight of 386.71 g/mol. Its IUPAC name is 2-(4-methylcyclohexyl)-5-[3-methyl-4-(4-methylcyclohexyl)pentan-2-yl]-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | 2-(4-methylcyclohexyl)-5-[3-methyl-4-(4-methylcyclohexyl)pentan-2-yl]-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 163912333 |
| Molecular Formula | C28H50 |
| Molecular Weight | 386.71 g/mol |
| Exact Mass | 386.39 |
| IUPAC Name | 2-(4-methylcyclohexyl)-5-[3-methyl-4-(4-methylcyclohexyl)pentan-2-yl]-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | CC1CCC(C2CC3CC(C(C)C(C)C(C)C4CCC(C)CC4)CC3C2)CC1 |
| InChI | InChI=1S/C28H50/c1-18-6-10-23(11-7-18)21(4)20(3)22(5)25-14-27-16-26(17-28(27)15-25)24-12-8-19(2)9-13-24/h18-28H,6-17H2,1-5H3 |
| InChIKey | QTFGWWBLBONARV-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.71 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |