About [1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol
[1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol (PubChem CID 163913216) has the molecular formula C11H11F3IN3OS
and a molecular weight of 417.19 g/mol. Its IUPAC name is [1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol |
| PubChem CID | 163913216 |
| Molecular Formula | C11H11F3IN3OS |
| Molecular Weight | 417.19 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | [1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol |
| SMILES | OCc1cn(-c2sc(C(F)(F)F)cc2I2CCC2)nn1 |
| InChI | InChI=1S/C11H11F3IN3OS/c12-11(13,14)9-4-8(15-2-1-3-15)10(20-9)18-5-7(6-19)16-17-18/h4-5,19H,1-3,6H2 |
| InChIKey | QTZOYRWSMOJSHX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol?
The IUPAC name of [1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol (CID 163913216) is [1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol.
What is the SMILES notation for [1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol?
The canonical SMILES for [1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol is OCc1cn(-c2sc(C(F)(F)F)cc2I2CCC2)nn1.
What is the InChIKey of [1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol?
The InChIKey is QTZOYRWSMOJSHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3IN3OS/c12-11(13,14)9-4-8(15-2-1-3-15)10(20-9)18-5-7(6-19)16-17-18/h4-5,19H,1-3,6H2.
What are the key properties of [1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol?
[1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol has a molecular weight of 417.19 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-(1λ3-iodetan-1-yl)-5-(trifluoromethyl)thiophen-2-yl]triazol-4-yl]methanol is sourced from PubChem (CID 163913216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).