About 7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid
7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid (PubChem CID 163913635) has the molecular formula C14H14O3S
and a molecular weight of 262.33 g/mol. Its IUPAC name is 7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid.
Molecular Properties
| Compound Name | 7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid |
| PubChem CID | 163913635 |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid |
| SMILES | CC1=Cc2c(oc3ccc(S(=O)O)cc23)CC1C |
| InChI | InChI=1S/C14H14O3S/c1-8-5-11-12-7-10(18(15)16)3-4-13(12)17-14(11)6-9(8)2/h3-5,7,9H,6H2,1-2H3,(H,15,16) |
| InChIKey | NHWWRNPCLPJNDO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid?
The IUPAC name of 7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid (CID 163913635) is 7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid.
What is the SMILES notation for 7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid?
The canonical SMILES for 7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid is CC1=Cc2c(oc3ccc(S(=O)O)cc23)CC1C.
What is the InChIKey of 7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid?
The InChIKey is NHWWRNPCLPJNDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O3S/c1-8-5-11-12-7-10(18(15)16)3-4-13(12)17-14(11)6-9(8)2/h3-5,7,9H,6H2,1-2H3,(H,15,16).
What are the key properties of 7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid?
7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid has a molecular weight of 262.33 g/mol, XLogP of 3.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethyl-6,7-dihydrodibenzofuran-2-sulfinic acid is sourced from PubChem (CID 163913635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).