C7H14N2 — CID 163914050
[(1R,2R)-2-methylcyclohex-3-en-1-yl]hydrazine (PubChem CID 163914050) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is [(1R,2R)-2-methylcyclohex-3-en-1-yl]hydrazine.
| Compound Name | [(1R,2R)-2-methylcyclohex-3-en-1-yl]hydrazine |
|---|---|
| PubChem CID | 163914050 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | [(1R,2R)-2-methylcyclohex-3-en-1-yl]hydrazine |
| SMILES | C[C@@H]1C=CCC[C@H]1NN |
| InChI | InChI=1S/C7H14N2/c1-6-4-2-3-5-7(6)9-8/h2,4,6-7,9H,3,5,8H2,1H3/t6-,7-/m1/s1 |
| InChIKey | QURCSGHDVYPIKI-RNFRBKRXSA-N |
| XLogP | 0.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|