About 2,7-dimethyl-4,5-dihydro-3H-azocin-6-one
2,7-dimethyl-4,5-dihydro-3H-azocin-6-one (PubChem CID 163915188) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2,7-dimethyl-4,5-dihydro-3H-azocin-6-one.
Molecular Properties
| Compound Name | 2,7-dimethyl-4,5-dihydro-3H-azocin-6-one |
| PubChem CID | 163915188 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 2,7-dimethyl-4,5-dihydro-3H-azocin-6-one |
| SMILES | CC1=C/N=C(/C)CCCC1=O |
| InChI | InChI=1S/C9H13NO/c1-7-6-10-8(2)4-3-5-9(7)11/h6H,3-5H2,1-2H3/b7-6?,10-8- |
| InChIKey | QVPRJRZSXCFKFA-CJHDCQNGSA-N |
| XLogP | 2.10 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-dimethyl-4,5-dihydro-3H-azocin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethyl-4,5-dihydro-3H-azocin-6-one?
The IUPAC name of 2,7-dimethyl-4,5-dihydro-3H-azocin-6-one (CID 163915188) is 2,7-dimethyl-4,5-dihydro-3H-azocin-6-one.
What is the SMILES notation for 2,7-dimethyl-4,5-dihydro-3H-azocin-6-one?
The canonical SMILES for 2,7-dimethyl-4,5-dihydro-3H-azocin-6-one is CC1=C/N=C(/C)CCCC1=O.
What is the InChIKey of 2,7-dimethyl-4,5-dihydro-3H-azocin-6-one?
The InChIKey is QVPRJRZSXCFKFA-CJHDCQNGSA-N. The full InChI is InChI=1S/C9H13NO/c1-7-6-10-8(2)4-3-5-9(7)11/h6H,3-5H2,1-2H3/b7-6?,10-8-.
What are the key properties of 2,7-dimethyl-4,5-dihydro-3H-azocin-6-one?
2,7-dimethyl-4,5-dihydro-3H-azocin-6-one has a molecular weight of 151.21 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-4,5-dihydro-3H-azocin-6-one is sourced from PubChem (CID 163915188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).