C24H24N2O5 — CID 163915771
4-[4-acetyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3H-1-benzazepin-8-yl]benzoic acid (PubChem CID 163915771) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is 4-[4-acetyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3H-1-benzazepin-8-yl]benzoic acid.
| Compound Name | 4-[4-acetyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3H-1-benzazepin-8-yl]benzoic acid |
|---|---|
| PubChem CID | 163915771 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-[4-acetyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3H-1-benzazepin-8-yl]benzoic acid |
| SMILES | CC(=O)C1=Cc2ccc(-c3ccc(C(=O)O)cc3)cc2N=C(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H24N2O5/c1-14(27)19-11-18-10-9-17(15-5-7-16(8-6-15)22(28)29)12-20(18)25-21(13-19)26-23(30)31-24(2,3)4/h5-12H,13H2,1-4H3,(H,28,29)(H,25,26,30) |
| InChIKey | RGODARZBENZKPG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |