C18H26N3O3- — CID 163916622
tert-butyl 4-[4-amino-3-[ethyl(oxido)amino]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 163916622) has the molecular formula C18H26N3O3- and a molecular weight of 332.42 g/mol. Its IUPAC name is tert-butyl 4-[4-amino-3-[ethyl(oxido)amino]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-amino-3-[ethyl(oxido)amino]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 163916622 |
| Molecular Formula | C18H26N3O3- |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | tert-butyl 4-[4-amino-3-[ethyl(oxido)amino]phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CCN([O-])c1cc(C2=CCN(C(=O)OC(C)(C)C)CC2)ccc1N |
| InChI | InChI=1S/C18H26N3O3/c1-5-21(23)16-12-14(6-7-15(16)19)13-8-10-20(11-9-13)17(22)24-18(2,3)4/h6-8,12H,5,9-11,19H2,1-4H3/q-1 |
| InChIKey | LTCKBKZBBVOKPY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|