C43H37N3O — CID 163916962
2-(6,9b-dihydro-3aH-phenalen-2-yl)-4-[2-(9,9-dimethyl-4a,5,9a,10a-tetrahydroxanthen-2-yl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 163916962) has the molecular formula C43H37N3O and a molecular weight of 611.79 g/mol. Its IUPAC name is 2-(6,9b-dihydro-3aH-phenalen-2-yl)-4-[2-(9,9-dimethyl-4a,5,9a,10a-tetrahydroxanthen-2-yl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(6,9b-dihydro-3aH-phenalen-2-yl)-4-[2-(9,9-dimethyl-4a,5,9a,10a-tetrahydroxanthen-2-yl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 163916962 |
| Molecular Formula | C43H37N3O |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | 2-(6,9b-dihydro-3aH-phenalen-2-yl)-4-[2-(9,9-dimethyl-4a,5,9a,10a-tetrahydroxanthen-2-yl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | CC1(C)C2=CC=CCC2OC2C=CC(c3ccccc3-c3nc(C4=CC5C=CCC6=CC=CC(=C4)C65)nc(-c4ccccc4)n3)=CC21 |
| InChI | InChI=1S/C43H37N3O/c1-43(2)35-20-8-9-21-37(35)47-38-23-22-29(26-36(38)43)33-18-6-7-19-34(33)42-45-40(28-12-4-3-5-13-28)44-41(46-42)32-24-30-16-10-14-27-15-11-17-31(25-32)39(27)30/h3-14,16-20,22-26,31,36-39H,15,21H2,1-2H3 |
| InChIKey | QXCBYAMLHZQWRU-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|