About 1,2-dimethoxy-1,2-dioxidohydrazine
1,2-dimethoxy-1,2-dioxidohydrazine (PubChem CID 163917150) has the molecular formula C2H6N2O4-2
and a molecular weight of 122.08 g/mol. Its IUPAC name is 1,2-dimethoxy-1,2-dioxidohydrazine.
Molecular Properties
| Compound Name | 1,2-dimethoxy-1,2-dioxidohydrazine |
| PubChem CID | 163917150 |
| Molecular Formula | C2H6N2O4-2 |
| Molecular Weight | 122.08 g/mol |
| Exact Mass | 122.03 |
| IUPAC Name | 1,2-dimethoxy-1,2-dioxidohydrazine |
| SMILES | CON([O-])N([O-])OC |
| InChI | InChI=1S/C2H6N2O4/c1-7-3(5)4(6)8-2/h1-2H3/q-2 |
| InChIKey | RDPXDDWLNHJVMQ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.08 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethoxy-1,2-dioxidohydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethoxy-1,2-dioxidohydrazine?
The IUPAC name of 1,2-dimethoxy-1,2-dioxidohydrazine (CID 163917150) is 1,2-dimethoxy-1,2-dioxidohydrazine.
What is the SMILES notation for 1,2-dimethoxy-1,2-dioxidohydrazine?
The canonical SMILES for 1,2-dimethoxy-1,2-dioxidohydrazine is CON([O-])N([O-])OC.
What is the InChIKey of 1,2-dimethoxy-1,2-dioxidohydrazine?
The InChIKey is RDPXDDWLNHJVMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O4/c1-7-3(5)4(6)8-2/h1-2H3/q-2.
What are the key properties of 1,2-dimethoxy-1,2-dioxidohydrazine?
1,2-dimethoxy-1,2-dioxidohydrazine has a molecular weight of 122.08 g/mol, XLogP of -0.38, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethoxy-1,2-dioxidohydrazine is sourced from PubChem (CID 163917150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).