About spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane]
spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane] (PubChem CID 163917413) has the molecular formula C8H12S
and a molecular weight of 140.25 g/mol. Its IUPAC name is spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane].
Molecular Properties
| Compound Name | spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane] |
| PubChem CID | 163917413 |
| Molecular Formula | C8H12S |
| Molecular Weight | 140.25 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane] |
| SMILES | C1CCC2(C1)CC1SC12 |
| InChI | InChI=1S/C8H12S/c1-2-4-8(3-1)5-6-7(8)9-6/h6-7H,1-5H2 |
| InChIKey | QXLPSAGNBSQLPZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane]?
The IUPAC name of spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane] (CID 163917413) is spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane].
What is the SMILES notation for spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane]?
The canonical SMILES for spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane] is C1CCC2(C1)CC1SC12.
What is the InChIKey of spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane]?
The InChIKey is QXLPSAGNBSQLPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12S/c1-2-4-8(3-1)5-6-7(8)9-6/h6-7H,1-5H2.
What are the key properties of spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane]?
spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane] has a molecular weight of 140.25 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[5-thiabicyclo[2.1.0]pentane-2,1'-cyclopentane] is sourced from PubChem (CID 163917413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).