C18H35NOS2 — CID 163917566
N,N-bis[1-(1-tert-butylsulfanylethyl)cyclopropyl]hydroxylamine (PubChem CID 163917566) has the molecular formula C18H35NOS2 and a molecular weight of 345.62 g/mol. Its IUPAC name is N,N-bis[1-(1-tert-butylsulfanylethyl)cyclopropyl]hydroxylamine.
| Compound Name | N,N-bis[1-(1-tert-butylsulfanylethyl)cyclopropyl]hydroxylamine |
|---|---|
| PubChem CID | 163917566 |
| Molecular Formula | C18H35NOS2 |
| Molecular Weight | 345.62 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | N,N-bis[1-(1-tert-butylsulfanylethyl)cyclopropyl]hydroxylamine |
| SMILES | CC(SC(C)(C)C)C1(N(O)C2(C(C)SC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C18H35NOS2/c1-13(21-15(3,4)5)17(9-10-17)19(20)18(11-12-18)14(2)22-16(6,7)8/h13-14,20H,9-12H2,1-8H3 |
| InChIKey | QXOVPPDUQQKOBU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|