About 1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane
1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane (PubChem CID 163917748) has the molecular formula C12H19F3S
and a molecular weight of 252.34 g/mol. Its IUPAC name is 1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane.
Molecular Properties
| Compound Name | 1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane |
| PubChem CID | 163917748 |
| Molecular Formula | C12H19F3S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane |
| SMILES | CC=C1CCC(CSCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H19F3S/c1-2-10-3-5-11(6-4-10)9-16-8-7-12(13,14)15/h2,11H,3-9H2,1H3/b10-2- |
| InChIKey | QXSCSUKLDOYXMA-SGAXSIHGSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane?
The IUPAC name of 1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane (CID 163917748) is 1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane.
What is the SMILES notation for 1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane?
The canonical SMILES for 1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane is CC=C1CCC(CSCCC(F)(F)F)CC1.
What is the InChIKey of 1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane?
The InChIKey is QXSCSUKLDOYXMA-SGAXSIHGSA-N. The full InChI is InChI=1S/C12H19F3S/c1-2-10-3-5-11(6-4-10)9-16-8-7-12(13,14)15/h2,11H,3-9H2,1H3/b10-2-.
What are the key properties of 1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane?
1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane has a molecular weight of 252.34 g/mol, XLogP of 4.81, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylidene-4-(3,3,3-trifluoropropylsulfanylmethyl)cyclohexane is sourced from PubChem (CID 163917748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).