5-methyliminopentanoic acid

C6H11NO2 — CID 163918635

IUPAC5-methyliminopentanoic acid
SMILESC/N=C/CCCC(=O)O
InChIInChI=1S/C6H11NO2/c1-7-5-3-2-4-6(8)9/h5H,2-4H2,1H3,(H,8,9)/b7-5+
InChIKeyQYMHJHXTHULHCP-FNORWQNLSA-N
MW129.16 g/mol
LogP0.94
Rot. Bonds4

About 5-methyliminopentanoic acid

5-methyliminopentanoic acid (PubChem CID 163918635) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is 5-methyliminopentanoic acid.

Molecular Properties

Compound Name5-methyliminopentanoic acid
PubChem CID163918635
Molecular FormulaC6H11NO2
Molecular Weight129.16 g/mol
Exact Mass129.08
IUPAC Name5-methyliminopentanoic acid
SMILESC/N=C/CCCC(=O)O
InChIInChI=1S/C6H11NO2/c1-7-5-3-2-4-6(8)9/h5H,2-4H2,1H3,(H,8,9)/b7-5+
InChIKeyQYMHJHXTHULHCP-FNORWQNLSA-N
XLogP0.94
TPSA49.66 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500129.16
LogP ≤ 50.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}

Analyze 5-methyliminopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyliminopentanoic acid?
The IUPAC name of 5-methyliminopentanoic acid (CID 163918635) is 5-methyliminopentanoic acid.
What is the SMILES notation for 5-methyliminopentanoic acid?
The canonical SMILES for 5-methyliminopentanoic acid is C/N=C/CCCC(=O)O.
What is the InChIKey of 5-methyliminopentanoic acid?
The InChIKey is QYMHJHXTHULHCP-FNORWQNLSA-N. The full InChI is InChI=1S/C6H11NO2/c1-7-5-3-2-4-6(8)9/h5H,2-4H2,1H3,(H,8,9)/b7-5+.
What are the key properties of 5-methyliminopentanoic acid?
5-methyliminopentanoic acid has a molecular weight of 129.16 g/mol, XLogP of 0.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyliminopentanoic acid is sourced from PubChem (CID 163918635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).