C18H8FN3O2 — CID 163918818
7-fluoro-3,12,14-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),4(9),5,7,11,13,15,17,19-nonaene-2,10-dione (PubChem CID 163918818) has the molecular formula C18H8FN3O2 and a molecular weight of 317.28 g/mol. Its IUPAC name is 7-fluoro-3,12,14-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),4(9),5,7,11,13,15,17,19-nonaene-2,10-dione.
| Compound Name | 7-fluoro-3,12,14-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),4(9),5,7,11,13,15,17,19-nonaene-2,10-dione |
|---|---|
| PubChem CID | 163918818 |
| Molecular Formula | C18H8FN3O2 |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 7-fluoro-3,12,14-triazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),4(9),5,7,11,13,15,17,19-nonaene-2,10-dione |
| SMILES | O=C1c2cc(F)ccc2-n2c1nc1nc3ccccc3cc1c2=O |
| InChI | InChI=1S/C18H8FN3O2/c19-10-5-6-14-11(8-10)15(23)17-21-16-12(18(24)22(14)17)7-9-3-1-2-4-13(9)20-16/h1-8H |
| InChIKey | QYQBERRFQBPFSG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|