About [4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium
[4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium (PubChem CID 163919078) has the molecular formula C12H18N3O2+
and a molecular weight of 236.29 g/mol. Its IUPAC name is [4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium.
Molecular Properties
| Compound Name | [4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium |
| PubChem CID | 163919078 |
| Molecular Formula | C12H18N3O2+ |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | [4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium |
| SMILES | C=Cc1cc(C(=O)NC2CCC([NH3+])CC2)no1 |
| InChI | InChI=1S/C12H17N3O2/c1-2-10-7-11(15-17-10)12(16)14-9-5-3-8(13)4-6-9/h2,7-9H,1,3-6,13H2,(H,14,16)/p+1 |
| InChIKey | QYVMHFCWHNNRFM-UHFFFAOYSA-O |
| XLogP | 0.60 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium?
The IUPAC name of [4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium (CID 163919078) is [4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium.
What is the SMILES notation for [4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium?
The canonical SMILES for [4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium is C=Cc1cc(C(=O)NC2CCC([NH3+])CC2)no1.
What is the InChIKey of [4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium?
The InChIKey is QYVMHFCWHNNRFM-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H17N3O2/c1-2-10-7-11(15-17-10)12(16)14-9-5-3-8(13)4-6-9/h2,7-9H,1,3-6,13H2,(H,14,16)/p+1.
What are the key properties of [4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium?
[4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium has a molecular weight of 236.29 g/mol, XLogP of 0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(5-ethenyl-1,2-oxazole-3-carbonyl)amino]cyclohexyl]azanium is sourced from PubChem (CID 163919078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).