About 2-phenyl-4H-1,3-benzoxathiine
2-phenyl-4H-1,3-benzoxathiine (PubChem CID 163919363) has the molecular formula C14H12OS
and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-phenyl-4H-1,3-benzoxathiine.
Molecular Properties
| Compound Name | 2-phenyl-4H-1,3-benzoxathiine |
| PubChem CID | 163919363 |
| Molecular Formula | C14H12OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-phenyl-4H-1,3-benzoxathiine |
| SMILES | c1ccc(C2Oc3ccccc3CS2)cc1 |
| InChI | InChI=1S/C14H12OS/c1-2-6-11(7-3-1)14-15-13-9-5-4-8-12(13)10-16-14/h1-9,14H,10H2 |
| InChIKey | QZBWIYHARVHYCX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-4H-1,3-benzoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-4H-1,3-benzoxathiine?
The IUPAC name of 2-phenyl-4H-1,3-benzoxathiine (CID 163919363) is 2-phenyl-4H-1,3-benzoxathiine.
What is the SMILES notation for 2-phenyl-4H-1,3-benzoxathiine?
The canonical SMILES for 2-phenyl-4H-1,3-benzoxathiine is c1ccc(C2Oc3ccccc3CS2)cc1.
What is the InChIKey of 2-phenyl-4H-1,3-benzoxathiine?
The InChIKey is QZBWIYHARVHYCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12OS/c1-2-6-11(7-3-1)14-15-13-9-5-4-8-12(13)10-16-14/h1-9,14H,10H2.
What are the key properties of 2-phenyl-4H-1,3-benzoxathiine?
2-phenyl-4H-1,3-benzoxathiine has a molecular weight of 228.32 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-4H-1,3-benzoxathiine is sourced from PubChem (CID 163919363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).