C18H12ClF2N3O2S — CID 163919489
N-[5-chloro-6-(2-ethenyl-5-fluorophenyl)-2-pyridinyl]-6-fluoropyridine-2-sulfonamide (PubChem CID 163919489) has the molecular formula C18H12ClF2N3O2S and a molecular weight of 407.83 g/mol. Its IUPAC name is N-[5-chloro-6-(2-ethenyl-5-fluorophenyl)-2-pyridinyl]-6-fluoropyridine-2-sulfonamide.
| Compound Name | N-[5-chloro-6-(2-ethenyl-5-fluorophenyl)-2-pyridinyl]-6-fluoropyridine-2-sulfonamide |
|---|---|
| PubChem CID | 163919489 |
| Molecular Formula | C18H12ClF2N3O2S |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | N-[5-chloro-6-(2-ethenyl-5-fluorophenyl)-2-pyridinyl]-6-fluoropyridine-2-sulfonamide |
| SMILES | C=Cc1ccc(F)cc1-c1nc(NS(=O)(=O)c2cccc(F)n2)ccc1Cl |
| InChI | InChI=1S/C18H12ClF2N3O2S/c1-2-11-6-7-12(20)10-13(11)18-14(19)8-9-16(23-18)24-27(25,26)17-5-3-4-15(21)22-17/h2-10H,1H2,(H,23,24) |
| InChIKey | JSPIDPCHSZOFJW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|