C47H33NO2S — CID 163920472
N-[4-(1,1-dioxo-5-phenylthiophen-2-yl)phenyl]-N,9,9-triphenylfluoren-2-amine (PubChem CID 163920472) has the molecular formula C47H33NO2S and a molecular weight of 675.85 g/mol. Its IUPAC name is N-[4-(1,1-dioxo-5-phenylthiophen-2-yl)phenyl]-N,9,9-triphenylfluoren-2-amine.
| Compound Name | N-[4-(1,1-dioxo-5-phenylthiophen-2-yl)phenyl]-N,9,9-triphenylfluoren-2-amine |
|---|---|
| PubChem CID | 163920472 |
| Molecular Formula | C47H33NO2S |
| Molecular Weight | 675.85 g/mol |
| Exact Mass | 675.22 |
| IUPAC Name | N-[4-(1,1-dioxo-5-phenylthiophen-2-yl)phenyl]-N,9,9-triphenylfluoren-2-amine |
| SMILES | O=S1(=O)C(c2ccccc2)=CC=C1c1ccc(N(c2ccccc2)c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C47H33NO2S/c49-51(50)45(34-15-5-1-6-16-34)31-32-46(51)35-25-27-39(28-26-35)48(38-21-11-4-12-22-38)40-29-30-42-41-23-13-14-24-43(41)47(44(42)33-40,36-17-7-2-8-18-36)37-19-9-3-10-20-37/h1-33H |
| InChIKey | QZZOEHRUQFOQHI-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.85 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |